About ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone
ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone (PubChem CID 162069516) has the molecular formula C21H24N2O5
and a molecular weight of 384.43 g/mol. Its IUPAC name is ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone |
| PubChem CID | 162069516 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone |
| SMILES | CCO.CCc1c(C(=O)c2ccc(OC)cc2)c2c([N+](=O)[O-])cccc2n1C |
| InChI | InChI=1S/C19H18N2O4.C2H6O/c1-4-14-18(19(22)12-8-10-13(25-3)11-9-12)17-15(20(14)2)6-5-7-16(17)21(23)24;1-2-3/h5-11H,4H2,1-3H3;3H,2H2,1H3 |
| InChIKey | ZAWSVTQGUMDGDP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone?
The IUPAC name of ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone (CID 162069516) is ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone.
What is the SMILES notation for ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone?
The canonical SMILES for ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone is CCO.CCc1c(C(=O)c2ccc(OC)cc2)c2c([N+](=O)[O-])cccc2n1C.
What is the InChIKey of ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone?
The InChIKey is ZAWSVTQGUMDGDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O4.C2H6O/c1-4-14-18(19(22)12-8-10-13(25-3)11-9-12)17-15(20(14)2)6-5-7-16(17)21(23)24;1-2-3/h5-11H,4H2,1-3H3;3H,2H2,1H3.
What are the key properties of ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone?
ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone has a molecular weight of 384.43 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;(2-ethyl-1-methyl-4-nitroindol-3-yl)-(4-methoxyphenyl)methanone is sourced from PubChem (CID 162069516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).