C19H16FN3O4 — CID 164519680
(6-fluoro-9-nitro-1,2,3,4-tetrahydropyrimido[1,2-a]indol-10-yl)-(4-methoxyphenyl)methanone (PubChem CID 164519680) has the molecular formula C19H16FN3O4 and a molecular weight of 369.35 g/mol. Its IUPAC name is (6-fluoro-9-nitro-1,2,3,4-tetrahydropyrimido[1,2-a]indol-10-yl)-(4-methoxyphenyl)methanone.
| Compound Name | (6-fluoro-9-nitro-1,2,3,4-tetrahydropyrimido[1,2-a]indol-10-yl)-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 164519680 |
| Molecular Formula | C19H16FN3O4 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (6-fluoro-9-nitro-1,2,3,4-tetrahydropyrimido[1,2-a]indol-10-yl)-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c3n(c4c(F)ccc([N+](=O)[O-])c24)CCCN3)cc1 |
| InChI | InChI=1S/C19H16FN3O4/c1-27-12-5-3-11(4-6-12)18(24)16-15-14(23(25)26)8-7-13(20)17(15)22-10-2-9-21-19(16)22/h3-8,21H,2,9-10H2,1H3 |
| InChIKey | HUXKFUULLFRXNP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|