C35H37N7O9 — CID 162069952
2-[[4-(1,6-dimethyl-7-oxopyrazolo[5,4-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methoxy]-N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]acetamide (PubChem CID 162069952) has the molecular formula C35H37N7O9 and a molecular weight of 699.72 g/mol. Its IUPAC name is 2-[[4-(1,6-dimethyl-7-oxopyrazolo[5,4-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methoxy]-N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]acetamide.
| Compound Name | 2-[[4-(1,6-dimethyl-7-oxopyrazolo[5,4-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methoxy]-N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 162069952 |
| Molecular Formula | C35H37N7O9 |
| Molecular Weight | 699.72 g/mol |
| Exact Mass | 699.27 |
| IUPAC Name | 2-[[4-(1,6-dimethyl-7-oxopyrazolo[5,4-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methoxy]-N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]acetamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3c2cnn3C)cc(OC)c1COCC(=O)NCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C35H37N7O9/c1-40-16-22(21-15-38-41(2)31(21)35(40)48)19-13-26(49-3)23(27(14-19)50-4)17-51-18-29(44)37-12-6-11-36-24-8-5-7-20-30(24)34(47)42(33(20)46)25-9-10-28(43)39-32(25)45/h5,7-8,13-16,25,36H,6,9-12,17-18H2,1-4H3,(H,37,44)(H,39,43,45) |
| InChIKey | NIOYIGORYOADQO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.72 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|