C22H16ClF6N5O2 — CID 162074020
6-chloro-2,4,8,14,23-pentazatetracyclo[15.3.1.13,7.19,13]tricosa-1(20),3,5,7(23),9,11,13(22),17(21),18-nonaene;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 162074020) has the molecular formula C22H16ClF6N5O2 and a molecular weight of 531.84 g/mol. Its IUPAC name is 6-chloro-2,4,8,14,23-pentazatetracyclo[15.3.1.13,7.19,13]tricosa-1(20),3,5,7(23),9,11,13(22),17(21),18-nonaene;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 6-chloro-2,4,8,14,23-pentazatetracyclo[15.3.1.13,7.19,13]tricosa-1(20),3,5,7(23),9,11,13(22),17(21),18-nonaene;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 162074020 |
| Molecular Formula | C22H16ClF6N5O2 |
| Molecular Weight | 531.84 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 6-chloro-2,4,8,14,23-pentazatetracyclo[15.3.1.13,7.19,13]tricosa-1(20),3,5,7(23),9,11,13(22),17(21),18-nonaene;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | Clc1cnc2nc1Nc1cccc(c1)NCCc1cccc(c1)N2.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H16ClN5.C4F6O2/c19-16-11-21-18-23-14-5-1-3-12(9-14)7-8-20-13-4-2-6-15(10-13)22-17(16)24-18;5-3(6,7)1(11)2(12)4(8,9)10/h1-6,9-11,20H,7-8H2,(H2,21,22,23,24); |
| InChIKey | ZBLVKVQNTKWOPW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.84 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|