C18H15ClN4O2 — CID 77136705
6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9,11,13(21),16(20),17-nonaene-14,15-diol (PubChem CID 77136705) has the molecular formula C18H15ClN4O2 and a molecular weight of 354.80 g/mol. Its IUPAC name is 6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9,11,13(21),16(20),17-nonaene-14,15-diol.
| Compound Name | 6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9,11,13(21),16(20),17-nonaene-14,15-diol |
|---|---|
| PubChem CID | 77136705 |
| Molecular Formula | C18H15ClN4O2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9,11,13(21),16(20),17-nonaene-14,15-diol |
| SMILES | OC1c2cccc(c2)Nc2ncc(Cl)c(n2)Nc2cccc(c2)C1O |
| InChI | InChI=1S/C18H15ClN4O2/c19-14-9-20-18-22-13-6-2-4-11(8-13)16(25)15(24)10-3-1-5-12(7-10)21-17(14)23-18/h1-9,15-16,24-25H,(H2,20,21,22,23) |
| InChIKey | XFNUOMOWAAPAET-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |