About azidomethane;benzene
azidomethane;benzene (PubChem CID 162077084) has the molecular formula C13H15N3
and a molecular weight of 213.28 g/mol. Its IUPAC name is azidomethane;benzene.
Molecular Properties
| Compound Name | azidomethane;benzene |
| PubChem CID | 162077084 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | azidomethane;benzene |
| SMILES | CN=[N+]=[N-].c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/2C6H6.CH3N3/c2*1-2-4-6-5-3-1;1-3-4-2/h2*1-6H;1H3 |
| InChIKey | ZBVPJGNGJNWTCQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidomethane;benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidomethane;benzene?
The IUPAC name of azidomethane;benzene (CID 162077084) is azidomethane;benzene.
What is the SMILES notation for azidomethane;benzene?
The canonical SMILES for azidomethane;benzene is CN=[N+]=[N-].c1ccccc1.c1ccccc1.
What is the InChIKey of azidomethane;benzene?
The InChIKey is ZBVPJGNGJNWTCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6.CH3N3/c2*1-2-4-6-5-3-1;1-3-4-2/h2*1-6H;1H3.
What are the key properties of azidomethane;benzene?
azidomethane;benzene has a molecular weight of 213.28 g/mol, XLogP of 4.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azidomethane;benzene is sourced from PubChem (CID 162077084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).