C22H23I2NO — CID 162077340
[4-[(dimethylamino)methyl]phenyl]-(2,6-dimethylnaphthalen-1-yl)methanone;molecular iodine (PubChem CID 162077340) has the molecular formula C22H23I2NO and a molecular weight of 571.24 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]phenyl]-(2,6-dimethylnaphthalen-1-yl)methanone;molecular iodine.
| Compound Name | [4-[(dimethylamino)methyl]phenyl]-(2,6-dimethylnaphthalen-1-yl)methanone;molecular iodine |
|---|---|
| PubChem CID | 162077340 |
| Molecular Formula | C22H23I2NO |
| Molecular Weight | 571.24 g/mol |
| Exact Mass | 570.99 |
| IUPAC Name | [4-[(dimethylamino)methyl]phenyl]-(2,6-dimethylnaphthalen-1-yl)methanone;molecular iodine |
| SMILES | Cc1ccc2c(C(=O)c3ccc(CN(C)C)cc3)c(C)ccc2c1.II |
| InChI | InChI=1S/C22H23NO.I2/c1-15-5-12-20-19(13-15)9-6-16(2)21(20)22(24)18-10-7-17(8-11-18)14-23(3)4;1-2/h5-13H,14H2,1-4H3; |
| InChIKey | ZBWMHDYUFIQRBX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.24 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|