C16H22N5O3S+ — CID 162077968
[(1-cyanopyrrolidin-3-yl)amino]-[3-(cyclopentylsulfamoyl)phenyl]-oxoazanium (PubChem CID 162077968) has the molecular formula C16H22N5O3S+ and a molecular weight of 364.45 g/mol. Its IUPAC name is [(1-cyanopyrrolidin-3-yl)amino]-[3-(cyclopentylsulfamoyl)phenyl]-oxoazanium.
| Compound Name | [(1-cyanopyrrolidin-3-yl)amino]-[3-(cyclopentylsulfamoyl)phenyl]-oxoazanium |
|---|---|
| PubChem CID | 162077968 |
| Molecular Formula | C16H22N5O3S+ |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | [(1-cyanopyrrolidin-3-yl)amino]-[3-(cyclopentylsulfamoyl)phenyl]-oxoazanium |
| SMILES | N#CN1CCC(N[N+](=O)c2cccc(S(=O)(=O)NC3CCCC3)c2)C1 |
| InChI | InChI=1S/C16H22N5O3S/c17-12-20-9-8-14(11-20)18-21(22)15-6-3-7-16(10-15)25(23,24)19-13-4-1-2-5-13/h3,6-7,10,13-14,19H,1-2,4-5,8-9,11H2,(H,18,22)/q+1 |
| InChIKey | YTLZEZKEQJVRKR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|