C15H11N4O+ — CID 162078326
9-(trideuteriomethyl)-11-oxa-4,9,17-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene (PubChem CID 162078326) has the molecular formula C15H11N4O+ and a molecular weight of 266.30 g/mol. Its IUPAC name is 9-(trideuteriomethyl)-11-oxa-4,9,17-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene.
| Compound Name | 9-(trideuteriomethyl)-11-oxa-4,9,17-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
|---|---|
| PubChem CID | 162078326 |
| Molecular Formula | C15H11N4O+ |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 9-(trideuteriomethyl)-11-oxa-4,9,17-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
| SMILES | [2H]C([2H])([2H])n1c2cccnc2c2c1oc1[n+]2Cc2ncccc2-1 |
| InChI | InChI=1S/C15H11N4O/c1-18-11-5-3-7-17-12(11)13-15(18)20-14-9-4-2-6-16-10(9)8-19(13)14/h2-7H,8H2,1H3/q+1/i1D3 |
| InChIKey | FWAAXRQZGKAKNC-FIBGUPNXSA-N |
| XLogP | 2.03 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|