C16H13N4+ — CID 157470911
11-methyl-3,11,17-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene (PubChem CID 157470911) has the molecular formula C16H13N4+ and a molecular weight of 261.31 g/mol. Its IUPAC name is 11-methyl-3,11,17-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene.
| Compound Name | 11-methyl-3,11,17-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
|---|---|
| PubChem CID | 157470911 |
| Molecular Formula | C16H13N4+ |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 11-methyl-3,11,17-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
| SMILES | Cn1c2[n+](c3c1cc1ccccn13)Cc1ncccc1-2 |
| InChI | InChI=1S/C16H13N4/c1-18-14-9-11-5-2-3-8-19(11)16(14)20-10-13-12(15(18)20)6-4-7-17-13/h2-9H,10H2,1H3/q+1 |
| InChIKey | SITFPVBDFWIRJJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|