C15H12N5+ — CID 158051165
11-methyl-3,7,9,11-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene (PubChem CID 158051165) has the molecular formula C15H12N5+ and a molecular weight of 262.30 g/mol. Its IUPAC name is 11-methyl-3,7,9,11-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene.
| Compound Name | 11-methyl-3,7,9,11-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene |
|---|---|
| PubChem CID | 158051165 |
| Molecular Formula | C15H12N5+ |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 11-methyl-3,7,9,11-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene |
| SMILES | Cn1c2[n+](c3c1nc1ncccn13)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H12N5/c1-18-12-14(19-8-4-7-16-15(19)17-12)20-9-10-5-2-3-6-11(10)13(18)20/h2-8H,9H2,1H3/q+1 |
| InChIKey | RKZZTZOADRZDSZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 39.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|