C13H8N5O+ — CID 162112218
11-oxa-3,7,9,14-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene (PubChem CID 162112218) has the molecular formula C13H8N5O+ and a molecular weight of 250.24 g/mol. Its IUPAC name is 11-oxa-3,7,9,14-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene.
| Compound Name | 11-oxa-3,7,9,14-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
|---|---|
| PubChem CID | 162112218 |
| Molecular Formula | C13H8N5O+ |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 11-oxa-3,7,9,14-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
| SMILES | c1cnc2c(c1)C[n+]1c-2oc2nc3ncccn3c21 |
| InChI | InChI=1S/C13H8N5O/c1-3-8-7-18-11-10(19-12(18)9(8)14-4-1)16-13-15-5-2-6-17(11)13/h1-6H,7H2/q+1 |
| InChIKey | SKBIKJVGSVWLPD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 60.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|