C16H12N3S+ — CID 160936818
3-methyl-11-thia-3,5-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13,15,17-octaene (PubChem CID 160936818) has the molecular formula C16H12N3S+ and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-methyl-11-thia-3,5-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13,15,17-octaene.
| Compound Name | 3-methyl-11-thia-3,5-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13,15,17-octaene |
|---|---|
| PubChem CID | 160936818 |
| Molecular Formula | C16H12N3S+ |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-methyl-11-thia-3,5-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13,15,17-octaene |
| SMILES | Cn1c2ncccc2c2sc3[n+](c21)Cc1ccccc1-3 |
| InChI | InChI=1S/C16H12N3S/c1-18-14-12(7-4-8-17-14)13-15(18)19-9-10-5-2-3-6-11(10)16(19)20-13/h2-8H,9H2,1H3/q+1 |
| InChIKey | NVWPCSRIXZKNAB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|