C15H11N4S+ — CID 162034722
9-methyl-11-thia-7,9,15-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene (PubChem CID 162034722) has the molecular formula C15H11N4S+ and a molecular weight of 279.35 g/mol. Its IUPAC name is 9-methyl-11-thia-7,9,15-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene.
| Compound Name | 9-methyl-11-thia-7,9,15-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
|---|---|
| PubChem CID | 162034722 |
| Molecular Formula | C15H11N4S+ |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 9-methyl-11-thia-7,9,15-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
| SMILES | Cn1c2ncccc2c2c1sc1[n+]2Cc2ccncc2-1 |
| InChI | InChI=1S/C15H11N4S/c1-18-13-10(3-2-5-17-13)12-15(18)20-14-11-7-16-6-4-9(11)8-19(12)14/h2-7H,8H2,1H3/q+1 |
| InChIKey | KSXZKHFNWOFBNR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|