About 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate
1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate (PubChem CID 162079726) has the molecular formula C14H14N2O5
and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate.
Molecular Properties
| Compound Name | 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate |
| PubChem CID | 162079726 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate |
| SMILES | C[n+]1cccc(C(=O)[O-])c1.Cn1cc(C(=O)O)ccc1=O |
| InChI | InChI=1S/C7H7NO3.C7H7NO2/c1-8-4-5(7(10)11)2-3-6(8)9;1-8-4-2-3-6(5-8)7(9)10/h2-4H,1H3,(H,10,11);2-5H,1H3 |
| InChIKey | WEIDWDNABIAJGI-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate?
The IUPAC name of 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate (CID 162079726) is 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate.
What is the SMILES notation for 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate?
The canonical SMILES for 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate is C[n+]1cccc(C(=O)[O-])c1.Cn1cc(C(=O)O)ccc1=O.
What is the InChIKey of 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate?
The InChIKey is WEIDWDNABIAJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.C7H7NO2/c1-8-4-5(7(10)11)2-3-6(8)9;1-8-4-2-3-6(5-8)7(9)10/h2-4H,1H3,(H,10,11);2-5H,1H3.
What are the key properties of 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate?
1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate has a molecular weight of 290.28 g/mol, XLogP of -1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-oxopyridine-3-carboxylic acid;1-methylpyridin-1-ium-3-carboxylate is sourced from PubChem (CID 162079726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).