C74H97Cl2N7O10S2 — CID 162080827
CID 162080827 (PubChem CID 162080827) has the molecular formula C74H97Cl2N7O10S2 and a molecular weight of 1379.67 g/mol.
| Compound Name | CID 162080827 |
|---|---|
| PubChem CID | 162080827 |
| Molecular Formula | C74H97Cl2N7O10S2 |
| Molecular Weight | 1379.67 g/mol |
| Exact Mass | 1377.61 |
| IUPAC Name | — |
| SMILES | C=S1(=O)NC(=O)c2ccc3c(c2)N(C[C@@H]2CC[C@H]2[C@@](O)(c2nccn2C)CCC[C@H](C)[C@H]1C)C[C@@]1(CCCc2cc(Cl)ccc21)CO3.C[C@@H]1[C@@H](C)CCCC2(OCC(N(C)C)CO2)[C@@H]2CC[C@H]2CN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)C(=O)NS1(=O)=O |
| InChI | InChI=1S/C37H47ClN4O4S.C37H50ClN3O6S/c1-24-7-5-16-37(44,35-39-17-18-41(35)3)31-12-9-28(31)21-42-22-36(15-6-8-26-19-29(38)11-13-30(26)36)23-46-33-14-10-27(20-32(33)42)34(43)40-47(4,45)25(24)2;1-24-7-5-16-37(46-20-30(21-47-37)40(3)4)32-12-9-28(32)19-41-22-36(15-6-8-26-17-29(38)11-13-31(26)36)23-45-34-14-10-27(18-33(34)41)35(42)39-48(43,44)25(24)2/h10-11,13-14,17-20,24-25,28,31,44H,4-9,12,15-16,21-23H2,1-3H3,(H,40,43,45);10-11,13-14,17-18,24-25,28,30,32H,5-9,12,15-16,19-23H2,1-4H3,(H,39,42)/t24-,25+,28-,31+,36-,37+,47?;24-,25+,28-,30?,32+,36-,37?/m00/s1 |
| InChIKey | ZCHXBEBAHKGYDK-DJDCRYIWSA-N |
| XLogP | 11.81 |
| TPSA | 194.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 95 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1379.67 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|