C7H14F4O2 — CID 162080870
ethanol;propan-2-one;1,1,1,2-tetrafluoroethane (PubChem CID 162080870) has the molecular formula C7H14F4O2 and a molecular weight of 206.18 g/mol. Its IUPAC name is ethanol;propan-2-one;1,1,1,2-tetrafluoroethane.
| Compound Name | ethanol;propan-2-one;1,1,1,2-tetrafluoroethane |
|---|---|
| PubChem CID | 162080870 |
| Molecular Formula | C7H14F4O2 |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethanol;propan-2-one;1,1,1,2-tetrafluoroethane |
| SMILES | CC(C)=O.CCO.FCC(F)(F)F |
| InChI | InChI=1S/C3H6O.C2H2F4.C2H6O/c1-3(2)4;3-1-2(4,5)6;1-2-3/h1-2H3;1H2;3H,2H2,1H3 |
| InChIKey | ZCIAKLBZDAJHCF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |