About 1-fluoropropan-2-one;methane;tetrafluoromethane
1-fluoropropan-2-one;methane;tetrafluoromethane (PubChem CID 159658714) has the molecular formula C8H21F5O
and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-fluoropropan-2-one;methane;tetrafluoromethane.
Molecular Properties
| Compound Name | 1-fluoropropan-2-one;methane;tetrafluoromethane |
| PubChem CID | 159658714 |
| Molecular Formula | C8H21F5O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-fluoropropan-2-one;methane;tetrafluoromethane |
| SMILES | C.C.C.C.CC(=O)CF.FC(F)(F)F |
| InChI | InChI=1S/C3H5FO.CF4.4CH4/c1-3(5)2-4;2-1(3,4)5;;;;/h2H2,1H3;;4*1H4 |
| InChIKey | MSMXXSYLBBRNCU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoropropan-2-one;methane;tetrafluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoropropan-2-one;methane;tetrafluoromethane?
The IUPAC name of 1-fluoropropan-2-one;methane;tetrafluoromethane (CID 159658714) is 1-fluoropropan-2-one;methane;tetrafluoromethane.
What is the SMILES notation for 1-fluoropropan-2-one;methane;tetrafluoromethane?
The canonical SMILES for 1-fluoropropan-2-one;methane;tetrafluoromethane is C.C.C.C.CC(=O)CF.FC(F)(F)F.
What is the InChIKey of 1-fluoropropan-2-one;methane;tetrafluoromethane?
The InChIKey is MSMXXSYLBBRNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5FO.CF4.4CH4/c1-3(5)2-4;2-1(3,4)5;;;;/h2H2,1H3;;4*1H4.
What are the key properties of 1-fluoropropan-2-one;methane;tetrafluoromethane?
1-fluoropropan-2-one;methane;tetrafluoromethane has a molecular weight of 228.25 g/mol, XLogP of 4.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoropropan-2-one;methane;tetrafluoromethane is sourced from PubChem (CID 159658714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).