C11H18FNO — CID 162092392
1-(6-fluoro-6-methyl-2-azaspiro[3.3]heptan-2-yl)-2-methylpropan-1-one (PubChem CID 162092392) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is 1-(6-fluoro-6-methyl-2-azaspiro[3.3]heptan-2-yl)-2-methylpropan-1-one.
| Compound Name | 1-(6-fluoro-6-methyl-2-azaspiro[3.3]heptan-2-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 162092392 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1-(6-fluoro-6-methyl-2-azaspiro[3.3]heptan-2-yl)-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CC2(C1)CC(C)(F)C2 |
| InChI | InChI=1S/C11H18FNO/c1-8(2)9(14)13-6-11(7-13)4-10(3,12)5-11/h8H,4-7H2,1-3H3 |
| InChIKey | ZDUFPLBTOAHWDO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |