C20H36F3NO6 — CID 162092993
2-[[(2S,3R,4R,5S)-4-methoxy-5-methyl-2-nonyloxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 162092993) has the molecular formula C20H36F3NO6 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[[(2S,3R,4R,5S)-4-methoxy-5-methyl-2-nonyloxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(2S,3R,4R,5S)-4-methoxy-5-methyl-2-nonyloxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162092993 |
| Molecular Formula | C20H36F3NO6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 2-[[(2S,3R,4R,5S)-4-methoxy-5-methyl-2-nonyloxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCC[C@@H]1OC[C@H](C)[C@@H](OC)[C@@H]1NCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H35NO4.C2HF3O2/c1-4-5-6-7-8-9-10-11-15-17(19-12-16(20)21)18(22-3)14(2)13-23-15;3-2(4,5)1(6)7/h14-15,17-19H,4-13H2,1-3H3,(H,20,21);(H,6,7)/t14-,15-,17+,18+;/m0./s1 |
| InChIKey | VAIVHLPUNWXZLO-QCFJNHAPSA-N |
| XLogP | 3.85 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|