C18H35NO4 — CID 152632683
2-[[(2S,3R,4S,5R)-4-methoxy-5-methyl-2-nonyloxan-3-yl]amino]acetic acid (PubChem CID 152632683) has the molecular formula C18H35NO4 and a molecular weight of 329.48 g/mol. Its IUPAC name is 2-[[(2S,3R,4S,5R)-4-methoxy-5-methyl-2-nonyloxan-3-yl]amino]acetic acid.
| Compound Name | 2-[[(2S,3R,4S,5R)-4-methoxy-5-methyl-2-nonyloxan-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 152632683 |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 2-[[(2S,3R,4S,5R)-4-methoxy-5-methyl-2-nonyloxan-3-yl]amino]acetic acid |
| SMILES | CCCCCCCCC[C@@H]1OC[C@@H](C)[C@H](OC)[C@@H]1NCC(=O)O |
| InChI | InChI=1S/C18H35NO4/c1-4-5-6-7-8-9-10-11-15-17(19-12-16(20)21)18(22-3)14(2)13-23-15/h14-15,17-19H,4-13H2,1-3H3,(H,20,21)/t14-,15+,17-,18+/m1/s1 |
| InChIKey | ZDWDSSITKALYIG-ATLSCFEFSA-N |
| XLogP | 3.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|