About (diheptylamino)methanol;hydrazine
(diheptylamino)methanol;hydrazine (PubChem CID 162096205) has the molecular formula C15H37N3O
and a molecular weight of 275.48 g/mol. Its IUPAC name is (diheptylamino)methanol;hydrazine.
Molecular Properties
| Compound Name | (diheptylamino)methanol;hydrazine |
| PubChem CID | 162096205 |
| Molecular Formula | C15H37N3O |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.29 |
| IUPAC Name | (diheptylamino)methanol;hydrazine |
| SMILES | CCCCCCCN(CO)CCCCCCC.NN |
| InChI | InChI=1S/C15H33NO.H4N2/c1-3-5-7-9-11-13-16(15-17)14-12-10-8-6-4-2;1-2/h17H,3-15H2,1-2H3;1-2H2 |
| InChIKey | ZEGVZXXACSCJFA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (diheptylamino)methanol;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diheptylamino)methanol;hydrazine?
The IUPAC name of (diheptylamino)methanol;hydrazine (CID 162096205) is (diheptylamino)methanol;hydrazine.
What is the SMILES notation for (diheptylamino)methanol;hydrazine?
The canonical SMILES for (diheptylamino)methanol;hydrazine is CCCCCCCN(CO)CCCCCCC.NN.
What is the InChIKey of (diheptylamino)methanol;hydrazine?
The InChIKey is ZEGVZXXACSCJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO.H4N2/c1-3-5-7-9-11-13-16(15-17)14-12-10-8-6-4-2;1-2/h17H,3-15H2,1-2H3;1-2H2.
What are the key properties of (diheptylamino)methanol;hydrazine?
(diheptylamino)methanol;hydrazine has a molecular weight of 275.48 g/mol, XLogP of 3.00, 13 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (diheptylamino)methanol;hydrazine is sourced from PubChem (CID 162096205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).