About 2-phenylquinazoline;1H-pyrrole
2-phenylquinazoline;1H-pyrrole (PubChem CID 162097748) has the molecular formula C18H15N3
and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-phenylquinazoline;1H-pyrrole.
Molecular Properties
| Compound Name | 2-phenylquinazoline;1H-pyrrole |
| PubChem CID | 162097748 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-phenylquinazoline;1H-pyrrole |
| SMILES | c1cc[nH]c1.c1ccc(-c2ncc3ccccc3n2)cc1 |
| InChI | InChI=1S/C14H10N2.C4H5N/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14;1-2-4-5-3-1/h1-10H;1-5H |
| InChIKey | ZEMBHDXIPAQGAZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylquinazoline;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylquinazoline;1H-pyrrole?
The IUPAC name of 2-phenylquinazoline;1H-pyrrole (CID 162097748) is 2-phenylquinazoline;1H-pyrrole.
What is the SMILES notation for 2-phenylquinazoline;1H-pyrrole?
The canonical SMILES for 2-phenylquinazoline;1H-pyrrole is c1cc[nH]c1.c1ccc(-c2ncc3ccccc3n2)cc1.
What is the InChIKey of 2-phenylquinazoline;1H-pyrrole?
The InChIKey is ZEMBHDXIPAQGAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2.C4H5N/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14;1-2-4-5-3-1/h1-10H;1-5H.
What are the key properties of 2-phenylquinazoline;1H-pyrrole?
2-phenylquinazoline;1H-pyrrole has a molecular weight of 273.34 g/mol, XLogP of 4.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylquinazoline;1H-pyrrole is sourced from PubChem (CID 162097748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).