C21H17NO4S — CID 162110360
3-[[5-(furan-3-yl)-2-methoxyphenyl]sulfonylmethyl]quinoline (PubChem CID 162110360) has the molecular formula C21H17NO4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 3-[[5-(furan-3-yl)-2-methoxyphenyl]sulfonylmethyl]quinoline.
| Compound Name | 3-[[5-(furan-3-yl)-2-methoxyphenyl]sulfonylmethyl]quinoline |
|---|---|
| PubChem CID | 162110360 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-[[5-(furan-3-yl)-2-methoxyphenyl]sulfonylmethyl]quinoline |
| SMILES | COc1ccc(-c2ccoc2)cc1S(=O)(=O)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C21H17NO4S/c1-25-20-7-6-16(18-8-9-26-13-18)11-21(20)27(23,24)14-15-10-17-4-2-3-5-19(17)22-12-15/h2-13H,14H2,1H3 |
| InChIKey | ZGBMZWHUTKHKHC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |