C23H31Cl2N3O7 — CID 162111340
1-hydroperoxyperoxybut-2-yne;methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate (PubChem CID 162111340) has the molecular formula C23H31Cl2N3O7 and a molecular weight of 532.42 g/mol. Its IUPAC name is 1-hydroperoxyperoxybut-2-yne;methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate.
| Compound Name | 1-hydroperoxyperoxybut-2-yne;methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162111340 |
| Molecular Formula | C23H31Cl2N3O7 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 1-hydroperoxyperoxybut-2-yne;methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate |
| SMILES | CC#CCOOOO.COC(=O)N1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)C(CN2CCCC2)C1 |
| InChI | InChI=1S/C19H25Cl2N3O3.C4H6O4/c1-27-19(26)23-8-9-24(15(13-23)12-22-6-2-3-7-22)18(25)11-14-4-5-16(20)17(21)10-14;1-2-3-4-6-8-7-5/h4-5,10,15H,2-3,6-9,11-13H2,1H3;5H,4H2,1H3 |
| InChIKey | ZGEQXBKRVWZMMU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|