C24H31Cl2N3O7 — CID 70362034
but-2-enedioic acid;ethyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate (PubChem CID 70362034) has the molecular formula C24H31Cl2N3O7 and a molecular weight of 544.43 g/mol. Its IUPAC name is but-2-enedioic acid;ethyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate.
| Compound Name | but-2-enedioic acid;ethyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70362034 |
| Molecular Formula | C24H31Cl2N3O7 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | but-2-enedioic acid;ethyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)C(CN2CCCC2)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H27Cl2N3O3.C4H4O4/c1-2-28-20(27)24-9-10-25(16(14-24)13-23-7-3-4-8-23)19(26)12-15-5-6-17(21)18(22)11-15;5-3(6)1-2-4(7)8/h5-6,11,16H,2-4,7-10,12-14H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | WKCYNBHDETVQBP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|