C23H28Cl2N2O7 — CID 67916880
but-2-enedioic acid;1-[2-(3,4-dichlorophenyl)acetyl]-2-(pyrrolidin-1-ylmethyl)piperidine-4-carboxylic acid (PubChem CID 67916880) has the molecular formula C23H28Cl2N2O7 and a molecular weight of 515.39 g/mol. Its IUPAC name is but-2-enedioic acid;1-[2-(3,4-dichlorophenyl)acetyl]-2-(pyrrolidin-1-ylmethyl)piperidine-4-carboxylic acid.
| Compound Name | but-2-enedioic acid;1-[2-(3,4-dichlorophenyl)acetyl]-2-(pyrrolidin-1-ylmethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 67916880 |
| Molecular Formula | C23H28Cl2N2O7 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | but-2-enedioic acid;1-[2-(3,4-dichlorophenyl)acetyl]-2-(pyrrolidin-1-ylmethyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)C(CN2CCCC2)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H24Cl2N2O3.C4H4O4/c20-16-4-3-13(9-17(16)21)10-18(24)23-8-5-14(19(25)26)11-15(23)12-22-6-1-2-7-22;5-3(6)1-2-4(7)8/h3-4,9,14-15H,1-2,5-8,10-12H2,(H,25,26);1-2H,(H,5,6)(H,7,8) |
| InChIKey | PJKRFXBFKPHZDT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|