C23H28Cl2N2O6 — CID 70383296
(Z)-but-2-enedioic acid;1-[[1-[2-(3,4-dichlorophenyl)acetyl]piperidin-2-yl]methyl]piperidin-4-one (PubChem CID 70383296) has the molecular formula C23H28Cl2N2O6 and a molecular weight of 499.39 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[[1-[2-(3,4-dichlorophenyl)acetyl]piperidin-2-yl]methyl]piperidin-4-one.
| Compound Name | (Z)-but-2-enedioic acid;1-[[1-[2-(3,4-dichlorophenyl)acetyl]piperidin-2-yl]methyl]piperidin-4-one |
|---|---|
| PubChem CID | 70383296 |
| Molecular Formula | C23H28Cl2N2O6 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[[1-[2-(3,4-dichlorophenyl)acetyl]piperidin-2-yl]methyl]piperidin-4-one |
| SMILES | O=C(O)/C=C\C(=O)O.O=C1CCN(CC2CCCCN2C(=O)Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H24Cl2N2O2.C4H4O4/c20-17-5-4-14(11-18(17)21)12-19(25)23-8-2-1-3-15(23)13-22-9-6-16(24)7-10-22;5-3(6)1-2-4(7)8/h4-5,11,15H,1-3,6-10,12-13H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ASPYCVFGROWCRN-BTJKTKAUSA-N |
| XLogP | 3.29 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|