C24H30Cl2N2O5 — CID 70383480
(Z)-but-2-enedioic acid;2-(3,4-dichlorophenyl)-1-[2-[(4-methylidenepiperidin-1-yl)methyl]piperidin-1-yl]ethanone (PubChem CID 70383480) has the molecular formula C24H30Cl2N2O5 and a molecular weight of 497.42 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-(3,4-dichlorophenyl)-1-[2-[(4-methylidenepiperidin-1-yl)methyl]piperidin-1-yl]ethanone.
| Compound Name | (Z)-but-2-enedioic acid;2-(3,4-dichlorophenyl)-1-[2-[(4-methylidenepiperidin-1-yl)methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70383480 |
| Molecular Formula | C24H30Cl2N2O5 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-(3,4-dichlorophenyl)-1-[2-[(4-methylidenepiperidin-1-yl)methyl]piperidin-1-yl]ethanone |
| SMILES | C=C1CCN(CC2CCCCN2C(=O)Cc2ccc(Cl)c(Cl)c2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H26Cl2N2O.C4H4O4/c1-15-7-10-23(11-8-15)14-17-4-2-3-9-24(17)20(25)13-16-5-6-18(21)19(22)12-16;5-3(6)1-2-4(7)8/h5-6,12,17H,1-4,7-11,13-14H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KUZGSEUFGIIYJN-BTJKTKAUSA-N |
| XLogP | 4.28 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|