C13H27NS — CID 162112310
(4S,7R)-4-amino-2,7,9-trimethyldecane-5-thione (PubChem CID 162112310) has the molecular formula C13H27NS and a molecular weight of 229.43 g/mol. Its IUPAC name is (4S,7R)-4-amino-2,7,9-trimethyldecane-5-thione.
| Compound Name | (4S,7R)-4-amino-2,7,9-trimethyldecane-5-thione |
|---|---|
| PubChem CID | 162112310 |
| Molecular Formula | C13H27NS |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | (4S,7R)-4-amino-2,7,9-trimethyldecane-5-thione |
| SMILES | CC(C)C[C@@H](C)CC(=S)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C13H27NS/c1-9(2)6-11(5)8-13(15)12(14)7-10(3)4/h9-12H,6-8,14H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | VRLRLPBEFSVEPM-NEPJUHHUSA-N |
| XLogP | 3.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|