C15H21NOY-2 — CID 162113135
(1S)-1-(3,4-dihydro-2H-chromen-7-yl)-N,N-di(ethyl)ethanamine;yttrium (PubChem CID 162113135) has the molecular formula C15H21NOY-2 and a molecular weight of 320.25 g/mol. Its IUPAC name is (1S)-1-(3,4-dihydro-2H-chromen-7-yl)-N,N-di(ethyl)ethanamine;yttrium.
| Compound Name | (1S)-1-(3,4-dihydro-2H-chromen-7-yl)-N,N-di(ethyl)ethanamine;yttrium |
|---|---|
| PubChem CID | 162113135 |
| Molecular Formula | C15H21NOY-2 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (1S)-1-(3,4-dihydro-2H-chromen-7-yl)-N,N-di(ethyl)ethanamine;yttrium |
| SMILES | [CH2-]CN(C[CH2-])[C@@H](C)c1ccc2c(c1)OCCC2.[Y] |
| InChI | InChI=1S/C15H21NO.Y/c1-4-16(5-2)12(3)14-9-8-13-7-6-10-17-15(13)11-14;/h8-9,11-12H,1-2,4-7,10H2,3H3;/q-2;/t12-;/m0./s1 |
| InChIKey | PYSCTZMKDRXRPV-YDALLXLXSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|