C14H14O8S6 — CID 162117953
dimethyl 2-sulfanylidene-1,3-dithiole-4,5-dicarboxylate;1,1-dimethyl-2-sulfanylidene-1,3-dithiole-4,5-dicarboxylic acid (PubChem CID 162117953) has the molecular formula C14H14O8S6 and a molecular weight of 502.66 g/mol. Its IUPAC name is dimethyl 2-sulfanylidene-1,3-dithiole-4,5-dicarboxylate;1,1-dimethyl-2-sulfanylidene-1,3-dithiole-4,5-dicarboxylic acid.
| Compound Name | dimethyl 2-sulfanylidene-1,3-dithiole-4,5-dicarboxylate;1,1-dimethyl-2-sulfanylidene-1,3-dithiole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 162117953 |
| Molecular Formula | C14H14O8S6 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 501.90 |
| IUPAC Name | dimethyl 2-sulfanylidene-1,3-dithiole-4,5-dicarboxylate;1,1-dimethyl-2-sulfanylidene-1,3-dithiole-4,5-dicarboxylic acid |
| SMILES | COC(=O)c1sc(=S)sc1C(=O)OC.CS1(C)C(=S)SC(C(=O)O)=C1C(=O)O |
| InChI | InChI=1S/C7H6O4S3.C7H8O4S3/c1-10-5(8)3-4(6(9)11-2)14-7(12)13-3;1-14(2)4(6(10)11)3(5(8)9)13-7(14)12/h1-2H3;1-2H3,(H,8,9)(H,10,11) |
| InChIKey | ZHAFDDNKZYQREC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'methylidene-1,3-dithiole', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|