C12H9CsO6S5 — CID 23714271
cesium 2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-5-methoxycarbonyl-1,3-dithiole-4-thiolate (PubChem CID 23714271) has the molecular formula C12H9CsO6S5 and a molecular weight of 542.44 g/mol. Its IUPAC name is cesium 2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-5-methoxycarbonyl-1,3-dithiole-4-thiolate.
| Compound Name | cesium 2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-5-methoxycarbonyl-1,3-dithiole-4-thiolate |
|---|---|
| PubChem CID | 23714271 |
| Molecular Formula | C12H9CsO6S5 |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 541.81 |
| IUPAC Name | cesium 2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-5-methoxycarbonyl-1,3-dithiole-4-thiolate |
| SMILES | COC(=O)C1=C([S-])SC(=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1.[Cs+] |
| InChI | InChI=1S/C12H10O6S5.Cs/c1-16-7(13)4-5(8(14)17-2)21-11(20-4)12-22-6(9(15)18-3)10(19)23-12;/h19H,1-3H3;/q;+1/p-1 |
| InChIKey | AWSVFIPWTIYLGQ-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|