C8H10O5S2 — CID 613082
dimethyl 2-methoxy-1,3-dithiole-4,5-dicarboxylate (PubChem CID 613082) has the molecular formula C8H10O5S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is dimethyl 2-methoxy-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-methoxy-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 613082 |
| Molecular Formula | C8H10O5S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | dimethyl 2-methoxy-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(OC)S1 |
| InChI | InChI=1S/C8H10O5S2/c1-11-6(9)4-5(7(10)12-2)15-8(13-3)14-4/h8H,1-3H3 |
| InChIKey | ROAWCSRWRQYAPD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |