C12H12O8S2 — CID 13308073
tetramethyl 1,4-dithiine-2,3,5,6-tetracarboxylate (PubChem CID 13308073) has the molecular formula C12H12O8S2 and a molecular weight of 348.35 g/mol. Its IUPAC name is tetramethyl 1,4-dithiine-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl 1,4-dithiine-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 13308073 |
| Molecular Formula | C12H12O8S2 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | tetramethyl 1,4-dithiine-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(C(=O)OC)=C(C(=O)OC)S1 |
| InChI | InChI=1S/C12H12O8S2/c1-17-9(13)5-6(10(14)18-2)22-8(12(16)20-4)7(21-5)11(15)19-3/h1-4H3 |
| InChIKey | GEJALPRNRWAASI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|