C25H56O3Si2 — CID 162119398
tert-butyl-dimethyl-[4-[(2S)-oxiran-2-yl]butoxy]silane;tert-butyl-hex-5-enoxy-dimethylsilane;methane (PubChem CID 162119398) has the molecular formula C25H56O3Si2 and a molecular weight of 460.89 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-[(2S)-oxiran-2-yl]butoxy]silane;tert-butyl-hex-5-enoxy-dimethylsilane;methane.
| Compound Name | tert-butyl-dimethyl-[4-[(2S)-oxiran-2-yl]butoxy]silane;tert-butyl-hex-5-enoxy-dimethylsilane;methane |
|---|---|
| PubChem CID | 162119398 |
| Molecular Formula | C25H56O3Si2 |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.38 |
| IUPAC Name | tert-butyl-dimethyl-[4-[(2S)-oxiran-2-yl]butoxy]silane;tert-butyl-hex-5-enoxy-dimethylsilane;methane |
| SMILES | C.C=CCCCCO[Si](C)(C)C(C)(C)C.CC(C)(C)[Si](C)(C)OCCCC[C@H]1CO1 |
| InChI | InChI=1S/C12H26O2Si.C12H26OSi.CH4/c1-12(2,3)15(4,5)14-9-7-6-8-11-10-13-11;1-7-8-9-10-11-13-14(5,6)12(2,3)4;/h11H,6-10H2,1-5H3;7H,1,8-11H2,2-6H3;1H4/t11-;;/m0../s1 |
| InChIKey | ZHFBMMKLUAPYHN-IDMXKUIJSA-N |
| XLogP | 8.58 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|