C22H48O2Si2 — CID 139252213
tert-butyl-dimethyl-[(5S)-5-tri(propan-2-yl)silyloxyhept-6-enoxy]silane (PubChem CID 139252213) has the molecular formula C22H48O2Si2 and a molecular weight of 400.80 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(5S)-5-tri(propan-2-yl)silyloxyhept-6-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(5S)-5-tri(propan-2-yl)silyloxyhept-6-enoxy]silane |
|---|---|
| PubChem CID | 139252213 |
| Molecular Formula | C22H48O2Si2 |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | tert-butyl-dimethyl-[(5S)-5-tri(propan-2-yl)silyloxyhept-6-enoxy]silane |
| SMILES | C=C[C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H48O2Si2/c1-13-21(24-26(18(2)3,19(4)5)20(6)7)16-14-15-17-23-25(11,12)22(8,9)10/h13,18-21H,1,14-17H2,2-12H3/t21-/m1/s1 |
| InChIKey | INILDTXILYKEPQ-OAQYLSRUSA-N |
| XLogP | 7.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|