About bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one
bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one (PubChem CID 162119507) has the molecular formula C15H19NO6
and a molecular weight of 309.32 g/mol. Its IUPAC name is bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one.
Molecular Properties
| Compound Name | bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one |
| PubChem CID | 162119507 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one |
| SMILES | CC(C)C(=O)C1(n2cccc2)CCOCC1.O=C=O.O=C=O |
| InChI | InChI=1S/C13H19NO2.2CO2/c1-11(2)12(15)13(5-9-16-10-6-13)14-7-3-4-8-14;2*2-1-3/h3-4,7-8,11H,5-6,9-10H2,1-2H3;; |
| InChIKey | ZHFKVVZNMIFVGN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 99.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one?
The IUPAC name of bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one (CID 162119507) is bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one.
What is the SMILES notation for bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one?
The canonical SMILES for bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one is CC(C)C(=O)C1(n2cccc2)CCOCC1.O=C=O.O=C=O.
What is the InChIKey of bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one?
The InChIKey is ZHFKVVZNMIFVGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.2CO2/c1-11(2)12(15)13(5-9-16-10-6-13)14-7-3-4-8-14;2*2-1-3/h3-4,7-8,11H,5-6,9-10H2,1-2H3;;.
What are the key properties of bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one?
bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one has a molecular weight of 309.32 g/mol, XLogP of 1.05, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(carbon dioxide);2-methyl-1-(4-pyrrol-1-yloxan-4-yl)propan-1-one is sourced from PubChem (CID 162119507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).