C22H25NO5 — CID 161162510
bis(carbon dioxide);2-methyl-1-[1-(2-phenylpyrrol-1-yl)cyclohexyl]propan-1-one (PubChem CID 161162510) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is bis(carbon dioxide);2-methyl-1-[1-(2-phenylpyrrol-1-yl)cyclohexyl]propan-1-one.
| Compound Name | bis(carbon dioxide);2-methyl-1-[1-(2-phenylpyrrol-1-yl)cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 161162510 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | bis(carbon dioxide);2-methyl-1-[1-(2-phenylpyrrol-1-yl)cyclohexyl]propan-1-one |
| SMILES | CC(C)C(=O)C1(n2cccc2-c2ccccc2)CCCCC1.O=C=O.O=C=O |
| InChI | InChI=1S/C20H25NO.2CO2/c1-16(2)19(22)20(13-7-4-8-14-20)21-15-9-12-18(21)17-10-5-3-6-11-17;2*2-1-3/h3,5-6,9-12,15-16H,4,7-8,13-14H2,1-2H3;; |
| InChIKey | UQCJLVRKEHXGCR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |