C16H24O4S — CID 10903059
(1S,2S)-1-[1-(benzenesulfonyl)cyclohexyl]-2-methylpropane-1,3-diol (PubChem CID 10903059) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is (1S,2S)-1-[1-(benzenesulfonyl)cyclohexyl]-2-methylpropane-1,3-diol.
| Compound Name | (1S,2S)-1-[1-(benzenesulfonyl)cyclohexyl]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 10903059 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (1S,2S)-1-[1-(benzenesulfonyl)cyclohexyl]-2-methylpropane-1,3-diol |
| SMILES | C[C@@H](CO)[C@H](O)C1(S(=O)(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C16H24O4S/c1-13(12-17)15(18)16(10-6-3-7-11-16)21(19,20)14-8-4-2-5-9-14/h2,4-5,8-9,13,15,17-18H,3,6-7,10-12H2,1H3/t13-,15-/m0/s1 |
| InChIKey | CDXUYBLVOLUXGM-ZFWWWQNUSA-N |
| XLogP | 2.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |