C18H24O9 — CID 162119918
ethene;4-ethenyl-1,3-dioxolan-2-one;(4Z)-4-[(2-oxo-1,3-dioxolan-4-yl)methylidene]-1,3-dioxolan-2-one (PubChem CID 162119918) has the molecular formula C18H24O9 and a molecular weight of 384.38 g/mol. Its IUPAC name is ethene;4-ethenyl-1,3-dioxolan-2-one;(4Z)-4-[(2-oxo-1,3-dioxolan-4-yl)methylidene]-1,3-dioxolan-2-one.
| Compound Name | ethene;4-ethenyl-1,3-dioxolan-2-one;(4Z)-4-[(2-oxo-1,3-dioxolan-4-yl)methylidene]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 162119918 |
| Molecular Formula | C18H24O9 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethene;4-ethenyl-1,3-dioxolan-2-one;(4Z)-4-[(2-oxo-1,3-dioxolan-4-yl)methylidene]-1,3-dioxolan-2-one |
| SMILES | C=C.C=C.C=C.C=CC1COC(=O)O1.O=C1OC/C(=C/C2COC(=O)O2)O1 |
| InChI | InChI=1S/C7H6O6.C5H6O3.3C2H4/c8-6-10-2-4(12-6)1-5-3-11-7(9)13-5;1-2-4-3-7-5(6)8-4;3*1-2/h1,4H,2-3H2;2,4H,1,3H2;3*1-2H2/b5-1-;;;; |
| InChIKey | ZHGREKLNBRDQGG-SXLXNGLZSA-N |
| XLogP | 3.69 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|