C9H10O6 — CID 159799122
ethene;(4Z)-4-[(2-oxo-1,3-dioxolan-4-yl)methylidene]-1,3-dioxolan-2-one (PubChem CID 159799122) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is ethene;(4Z)-4-[(2-oxo-1,3-dioxolan-4-yl)methylidene]-1,3-dioxolan-2-one.
| Compound Name | ethene;(4Z)-4-[(2-oxo-1,3-dioxolan-4-yl)methylidene]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 159799122 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | ethene;(4Z)-4-[(2-oxo-1,3-dioxolan-4-yl)methylidene]-1,3-dioxolan-2-one |
| SMILES | C=C.O=C1OC/C(=C/C2COC(=O)O2)O1 |
| InChI | InChI=1S/C7H6O6.C2H4/c8-6-10-2-4(12-6)1-5-3-11-7(9)13-5;1-2/h1,4H,2-3H2;1-2H2/b5-1-; |
| InChIKey | NJODCYKPBITEIW-QYUSEIPKSA-N |
| XLogP | 1.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|