C6H8O3 — CID 23361415
4-[(E)-prop-1-enyl]-1,3-dioxolan-2-one (PubChem CID 23361415) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is 4-[(E)-prop-1-enyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[(E)-prop-1-enyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 23361415 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 4-[(E)-prop-1-enyl]-1,3-dioxolan-2-one |
| SMILES | C/C=C/C1COC(=O)O1 |
| InChI | InChI=1S/C6H8O3/c1-2-3-5-4-8-6(7)9-5/h2-3,5H,4H2,1H3/b3-2+ |
| InChIKey | RYSIHJHRLINCDU-NSCUHMNNSA-N |
| XLogP | 1.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|