C8H10O4 — CID 91192097
4-ethylidene-5-(1-methoxyethenyl)-1,3-dioxolan-2-one (PubChem CID 91192097) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 4-ethylidene-5-(1-methoxyethenyl)-1,3-dioxolan-2-one.
| Compound Name | 4-ethylidene-5-(1-methoxyethenyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 91192097 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4-ethylidene-5-(1-methoxyethenyl)-1,3-dioxolan-2-one |
| SMILES | C=C(OC)C1OC(=O)OC1=CC |
| InChI | InChI=1S/C8H10O4/c1-4-6-7(5(2)10-3)12-8(9)11-6/h4,7H,2H2,1,3H3 |
| InChIKey | AWKPIVORNIUSKE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|