C72H108O9 — CID 162126660
1,2,4-tris[[4-(6-prop-1-enoxydodecoxy)phenyl]methoxy]benzene (PubChem CID 162126660) has the molecular formula C72H108O9 and a molecular weight of 1117.65 g/mol. Its IUPAC name is 1,2,4-tris[[4-(6-prop-1-enoxydodecoxy)phenyl]methoxy]benzene.
| Compound Name | 1,2,4-tris[[4-(6-prop-1-enoxydodecoxy)phenyl]methoxy]benzene |
|---|---|
| PubChem CID | 162126660 |
| Molecular Formula | C72H108O9 |
| Molecular Weight | 1117.65 g/mol |
| Exact Mass | 1116.80 |
| IUPAC Name | 1,2,4-tris[[4-(6-prop-1-enoxydodecoxy)phenyl]methoxy]benzene |
| SMILES | CC=COC(CCCCCC)CCCCCOc1ccc(COc2ccc(OCc3ccc(OCCCCCC(CCCCCC)OC=CC)cc3)c(OCc3ccc(OCCCCCC(CCCCCC)OC=CC)cc3)c2)cc1 |
| InChI | InChI=1S/C72H108O9/c1-7-13-16-22-31-64(73-51-10-4)34-25-19-28-54-76-67-43-37-61(38-44-67)58-79-70-49-50-71(80-59-62-39-45-68(46-40-62)77-55-29-20-26-35-65(74-52-11-5)32-23-17-14-8-2)72(57-70)81-60-63-41-47-69(48-42-63)78-56-30-21-27-36-66(75-53-12-6)33-24-18-15-9-3/h10-12,37-53,57,64-66H,7-9,13-36,54-56,58-60H2,1-6H3 |
| InChIKey | ZICVVFOJNQZGAP-UHFFFAOYSA-N |
| XLogP | 20.91 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.65 |
| LogP ≤ 5 | 20.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|