C12H18ClF3N2OS2 — CID 162132491
(2S,3S)-2-methyl-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;sulfane;hydrochloride (PubChem CID 162132491) has the molecular formula C12H18ClF3N2OS2 and a molecular weight of 362.87 g/mol. Its IUPAC name is (2S,3S)-2-methyl-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;sulfane;hydrochloride.
| Compound Name | (2S,3S)-2-methyl-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;sulfane;hydrochloride |
|---|---|
| PubChem CID | 162132491 |
| Molecular Formula | C12H18ClF3N2OS2 |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (2S,3S)-2-methyl-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;sulfane;hydrochloride |
| SMILES | C[C@@H]1NCC[C@@H]1C(=O)Nc1cc(F)c(F)c(F)c1.Cl.S.S |
| InChI | InChI=1S/C12H13F3N2O.ClH.2H2S/c1-6-8(2-3-16-6)12(18)17-7-4-9(13)11(15)10(14)5-7;;;/h4-6,8,16H,2-3H2,1H3,(H,17,18);1H;2*1H2/t6-,8-;;;/m0.../s1 |
| InChIKey | MMDARHHYOGVSPP-VXIRAHSWSA-N |
| XLogP | 2.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|