C28H35IO4 — CID 162132974
methyl 4-(cyclobutylmethyl)-5-iodo-2-methylbenzoate;methyl 4-(cyclobutylmethyl)-2-methylbenzoate (PubChem CID 162132974) has the molecular formula C28H35IO4 and a molecular weight of 562.49 g/mol. Its IUPAC name is methyl 4-(cyclobutylmethyl)-5-iodo-2-methylbenzoate;methyl 4-(cyclobutylmethyl)-2-methylbenzoate.
| Compound Name | methyl 4-(cyclobutylmethyl)-5-iodo-2-methylbenzoate;methyl 4-(cyclobutylmethyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 162132974 |
| Molecular Formula | C28H35IO4 |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | methyl 4-(cyclobutylmethyl)-5-iodo-2-methylbenzoate;methyl 4-(cyclobutylmethyl)-2-methylbenzoate |
| SMILES | COC(=O)c1cc(I)c(CC2CCC2)cc1C.COC(=O)c1ccc(CC2CCC2)cc1C |
| InChI | InChI=1S/C14H17IO2.C14H18O2/c1-9-6-11(7-10-4-3-5-10)13(15)8-12(9)14(16)17-2;1-10-8-12(9-11-4-3-5-11)6-7-13(10)14(15)16-2/h6,8,10H,3-5,7H2,1-2H3;6-8,11H,3-5,9H2,1-2H3 |
| InChIKey | ZIXFRSZJXNNACF-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|