C28H37IO6 — CID 158147651
4-cyclobutyl-5-iodo-2-methylbenzoic acid;4-cyclobutyl-5-methoxycarbonyl-2-methylbenzoic acid;methane (PubChem CID 158147651) has the molecular formula C28H37IO6 and a molecular weight of 596.50 g/mol. Its IUPAC name is 4-cyclobutyl-5-iodo-2-methylbenzoic acid;4-cyclobutyl-5-methoxycarbonyl-2-methylbenzoic acid;methane.
| Compound Name | 4-cyclobutyl-5-iodo-2-methylbenzoic acid;4-cyclobutyl-5-methoxycarbonyl-2-methylbenzoic acid;methane |
|---|---|
| PubChem CID | 158147651 |
| Molecular Formula | C28H37IO6 |
| Molecular Weight | 596.50 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 4-cyclobutyl-5-iodo-2-methylbenzoic acid;4-cyclobutyl-5-methoxycarbonyl-2-methylbenzoic acid;methane |
| SMILES | C.C.COC(=O)c1cc(C(=O)O)c(C)cc1C1CCC1.Cc1cc(C2CCC2)c(I)cc1C(=O)O |
| InChI | InChI=1S/C14H16O4.C12H13IO2.2CH4/c1-8-6-11(9-4-3-5-9)12(14(17)18-2)7-10(8)13(15)16;1-7-5-10(8-3-2-4-8)11(13)6-9(7)12(14)15;;/h6-7,9H,3-5H2,1-2H3,(H,15,16);5-6,8H,2-4H2,1H3,(H,14,15);2*1H4 |
| InChIKey | FUSCNLXCOYFUII-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.50 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|