C13H15NO3S — CID 141349895
methyl 2-cyclopropyl-4-methyl-5-(sulfanylcarbamoyl)benzoate (PubChem CID 141349895) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl 2-cyclopropyl-4-methyl-5-(sulfanylcarbamoyl)benzoate.
| Compound Name | methyl 2-cyclopropyl-4-methyl-5-(sulfanylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 141349895 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methyl 2-cyclopropyl-4-methyl-5-(sulfanylcarbamoyl)benzoate |
| SMILES | COC(=O)c1cc(C(=O)NS)c(C)cc1C1CC1 |
| InChI | InChI=1S/C13H15NO3S/c1-7-5-10(8-3-4-8)11(13(16)17-2)6-9(7)12(15)14-18/h5-6,8,18H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | GPEOTBYFLNETLU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|