About iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate
iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate (PubChem CID 167589294) has the molecular formula C15H21IN2O2
and a molecular weight of 388.25 g/mol. Its IUPAC name is iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate.
Molecular Properties
| Compound Name | iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate |
| PubChem CID | 167589294 |
| Molecular Formula | C15H21IN2O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate |
| SMILES | CI.[H]/N=C(\N)c1cc(C(=O)OC)c(C)cc1C1CCC1 |
| InChI | InChI=1S/C14H18N2O2.CH3I/c1-8-6-11(9-4-3-5-9)12(13(15)16)7-10(8)14(17)18-2;1-2/h6-7,9H,3-5H2,1-2H3,(H3,15,16);1H3 |
| InChIKey | IFFIUNQEORBHPZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate?
The IUPAC name of iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate (CID 167589294) is iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate.
What is the SMILES notation for iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate?
The canonical SMILES for iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate is CI.[H]/N=C(\N)c1cc(C(=O)OC)c(C)cc1C1CCC1.
What is the InChIKey of iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate?
The InChIKey is IFFIUNQEORBHPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2.CH3I/c1-8-6-11(9-4-3-5-9)12(13(15)16)7-10(8)14(17)18-2;1-2/h6-7,9H,3-5H2,1-2H3,(H3,15,16);1H3.
What are the key properties of iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate?
iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate has a molecular weight of 388.25 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethane;methyl 5-carbamimidoyl-4-cyclobutyl-2-methylbenzoate is sourced from PubChem (CID 167589294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).